C16H29N3O2 — CID 106806662
2-ethyl-2-(propan-2-ylamino)-5-(2-propylimidazol-1-yl)pentanoic acid (PubChem CID 106806662) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-ethyl-2-(propan-2-ylamino)-5-(2-propylimidazol-1-yl)pentanoic acid.
| Compound Name | 2-ethyl-2-(propan-2-ylamino)-5-(2-propylimidazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 106806662 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-ethyl-2-(propan-2-ylamino)-5-(2-propylimidazol-1-yl)pentanoic acid |
| SMILES | CCCc1nccn1CCCC(CC)(NC(C)C)C(=O)O |
| InChI | InChI=1S/C16H29N3O2/c1-5-8-14-17-10-12-19(14)11-7-9-16(6-2,15(20)21)18-13(3)4/h10,12-13,18H,5-9,11H2,1-4H3,(H,20,21) |
| InChIKey | OFLPHAQPZZDHPU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |