C11H17F6NO3 — CID 106807178
2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(methylamino)pentanoic acid (PubChem CID 106807178) has the molecular formula C11H17F6NO3 and a molecular weight of 325.25 g/mol. Its IUPAC name is 2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(methylamino)pentanoic acid.
| Compound Name | 2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 106807178 |
| Molecular Formula | C11H17F6NO3 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-ethyl-5-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-(methylamino)pentanoic acid |
| SMILES | CCC(CCCOC(C(F)(F)F)C(F)(F)F)(NC)C(=O)O |
| InChI | InChI=1S/C11H17F6NO3/c1-3-9(18-2,8(19)20)5-4-6-21-7(10(12,13)14)11(15,16)17/h7,18H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | OPZPCWGTMADEPN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|