C13H19Cl2NOS — CID 106808065
6-(2,6-dichlorophenyl)sulfinyl-N-methylhexan-3-amine (PubChem CID 106808065) has the molecular formula C13H19Cl2NOS and a molecular weight of 308.27 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)sulfinyl-N-methylhexan-3-amine.
| Compound Name | 6-(2,6-dichlorophenyl)sulfinyl-N-methylhexan-3-amine |
|---|---|
| PubChem CID | 106808065 |
| Molecular Formula | C13H19Cl2NOS |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 6-(2,6-dichlorophenyl)sulfinyl-N-methylhexan-3-amine |
| SMILES | CCC(CCCS(=O)c1c(Cl)cccc1Cl)NC |
| InChI | InChI=1S/C13H19Cl2NOS/c1-3-10(16-2)6-5-9-18(17)13-11(14)7-4-8-12(13)15/h4,7-8,10,16H,3,5-6,9H2,1-2H3 |
| InChIKey | TWDVFZMSTFHUFC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |