C14H21Cl2NOS — CID 106808043
6-(3,4-dichlorophenyl)sulfinyl-N-ethylhexan-3-amine (PubChem CID 106808043) has the molecular formula C14H21Cl2NOS and a molecular weight of 322.30 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)sulfinyl-N-ethylhexan-3-amine.
| Compound Name | 6-(3,4-dichlorophenyl)sulfinyl-N-ethylhexan-3-amine |
|---|---|
| PubChem CID | 106808043 |
| Molecular Formula | C14H21Cl2NOS |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 6-(3,4-dichlorophenyl)sulfinyl-N-ethylhexan-3-amine |
| SMILES | CCNC(CC)CCCS(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H21Cl2NOS/c1-3-11(17-4-2)6-5-9-19(18)12-7-8-13(15)14(16)10-12/h7-8,10-11,17H,3-6,9H2,1-2H3 |
| InChIKey | DVJHJUKENIHTLB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |