C8H13ClN4OS — CID 106812041
5-chloro-4-N-(2-ethylsulfinylethyl)pyrimidine-4,6-diamine (PubChem CID 106812041) has the molecular formula C8H13ClN4OS and a molecular weight of 248.74 g/mol. Its IUPAC name is 5-chloro-4-N-(2-ethylsulfinylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-chloro-4-N-(2-ethylsulfinylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 106812041 |
| Molecular Formula | C8H13ClN4OS |
| Molecular Weight | 248.74 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 5-chloro-4-N-(2-ethylsulfinylethyl)pyrimidine-4,6-diamine |
| SMILES | CCS(=O)CCNc1ncnc(N)c1Cl |
| InChI | InChI=1S/C8H13ClN4OS/c1-2-15(14)4-3-11-8-6(9)7(10)12-5-13-8/h5H,2-4H2,1H3,(H3,10,11,12,13) |
| InChIKey | BGHNQFJSOGZUPI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.74 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |