C15H22O2 — CID 10681215
(1S,3R,6R,7S,9R)-3,6-dimethyl-9-propan-2-yltricyclo[4.3.1.03,7]decane-2,5-dione (PubChem CID 10681215) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1S,3R,6R,7S,9R)-3,6-dimethyl-9-propan-2-yltricyclo[4.3.1.03,7]decane-2,5-dione.
| Compound Name | (1S,3R,6R,7S,9R)-3,6-dimethyl-9-propan-2-yltricyclo[4.3.1.03,7]decane-2,5-dione |
|---|---|
| PubChem CID | 10681215 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1S,3R,6R,7S,9R)-3,6-dimethyl-9-propan-2-yltricyclo[4.3.1.03,7]decane-2,5-dione |
| SMILES | CC(C)[C@H]1C[C@H]2[C@@]3(C)C[C@@H]1C(=O)[C@]2(C)CC3=O |
| InChI | InChI=1S/C15H22O2/c1-8(2)9-5-11-14(3)6-10(9)13(17)15(11,4)7-12(14)16/h8-11H,5-7H2,1-4H3/t9-,10+,11+,14-,15-/m1/s1 |
| InChIKey | HEMBWBQQSSVUPN-CDYMVBJSSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |