C10H15NO2 — CID 134859562
(4R)-1-hydroxy-3-methyl-2-oxo-4-propan-2-ylcyclopentane-1-carbonitrile (PubChem CID 134859562) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (4R)-1-hydroxy-3-methyl-2-oxo-4-propan-2-ylcyclopentane-1-carbonitrile.
| Compound Name | (4R)-1-hydroxy-3-methyl-2-oxo-4-propan-2-ylcyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 134859562 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (4R)-1-hydroxy-3-methyl-2-oxo-4-propan-2-ylcyclopentane-1-carbonitrile |
| SMILES | CC(C)[C@H]1CC(O)(C#N)C(=O)C1C |
| InChI | InChI=1S/C10H15NO2/c1-6(2)8-4-10(13,5-11)9(12)7(8)3/h6-8,13H,4H2,1-3H3/t7?,8-,10?/m1/s1 |
| InChIKey | LRFNVXNZCYQEBH-CCNFQMFXSA-N |
| XLogP | 1.12 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|