C13H13N3O2 — CID 132648228
(1R,3aS,4R,6aS)-3-hydroxy-3a,6a-dimethyl-6-oxo-1,2,4,5-tetrahydropentalene-1,3,4-tricarbonitrile (PubChem CID 132648228) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (1R,3aS,4R,6aS)-3-hydroxy-3a,6a-dimethyl-6-oxo-1,2,4,5-tetrahydropentalene-1,3,4-tricarbonitrile.
| Compound Name | (1R,3aS,4R,6aS)-3-hydroxy-3a,6a-dimethyl-6-oxo-1,2,4,5-tetrahydropentalene-1,3,4-tricarbonitrile |
|---|---|
| PubChem CID | 132648228 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (1R,3aS,4R,6aS)-3-hydroxy-3a,6a-dimethyl-6-oxo-1,2,4,5-tetrahydropentalene-1,3,4-tricarbonitrile |
| SMILES | C[C@@]12C(=O)C[C@@H](C#N)[C@]1(C)C(O)(C#N)C[C@H]2C#N |
| InChI | InChI=1S/C13H13N3O2/c1-11-9(6-15)4-13(18,7-16)12(11,2)8(5-14)3-10(11)17/h8-9,18H,3-4H2,1-2H3/t8-,9-,11+,12-,13?/m0/s1 |
| InChIKey | HRRDIXPWKHWEJL-CUEFOKDHSA-N |
| XLogP | 0.91 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|