C11H19N3O — CID 106815543
[2-(2-ethoxyethyl)-4,6-dimethylpyrimidin-5-yl]methanamine (PubChem CID 106815543) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is [2-(2-ethoxyethyl)-4,6-dimethylpyrimidin-5-yl]methanamine.
| Compound Name | [2-(2-ethoxyethyl)-4,6-dimethylpyrimidin-5-yl]methanamine |
|---|---|
| PubChem CID | 106815543 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | [2-(2-ethoxyethyl)-4,6-dimethylpyrimidin-5-yl]methanamine |
| SMILES | CCOCCc1nc(C)c(CN)c(C)n1 |
| InChI | InChI=1S/C11H19N3O/c1-4-15-6-5-11-13-8(2)10(7-12)9(3)14-11/h4-7,12H2,1-3H3 |
| InChIKey | XQLDDLFHDQSXIC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|