About 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine
3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine (PubChem CID 62745596) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine.
Analyze 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine?
The IUPAC name of 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine (CID 62745596) is 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine.
What is the SMILES notation for 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine?
The canonical SMILES for 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine is CCCc1nc(C)c(CCCN)c(C)n1.
What is the InChIKey of 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine?
The InChIKey is LSBQVAUMYACGNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-4-6-12-14-9(2)11(7-5-8-13)10(3)15-12/h4-8,13H2,1-3H3.
What are the key properties of 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine?
3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine has a molecular weight of 207.32 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethyl-2-propylpyrimidin-5-yl)propan-1-amine is sourced from PubChem (CID 62745596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).