C12H24O3Si — CID 10681766
(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylbut-3-en-1-ol (PubChem CID 10681766) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylbut-3-en-1-ol.
| Compound Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10681766 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylbut-3-en-1-ol |
| SMILES | C=C(C[C@H](O)[C@H]1COC(C)(C)O1)[Si](C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-9(16(4,5)6)7-10(13)11-8-14-12(2,3)15-11/h10-11,13H,1,7-8H2,2-6H3/t10-,11+/m0/s1 |
| InChIKey | KCIABBQYTSGMOF-WDEREUQCSA-N |
| XLogP | 2.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|