C12H22O3Si — CID 14295006
1-(2-methyl-1,3-dioxolan-2-yl)-3-trimethylsilylpenta-3,4-dien-2-ol (PubChem CID 14295006) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxolan-2-yl)-3-trimethylsilylpenta-3,4-dien-2-ol.
| Compound Name | 1-(2-methyl-1,3-dioxolan-2-yl)-3-trimethylsilylpenta-3,4-dien-2-ol |
|---|---|
| PubChem CID | 14295006 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-(2-methyl-1,3-dioxolan-2-yl)-3-trimethylsilylpenta-3,4-dien-2-ol |
| SMILES | C=C=C(C(O)CC1(C)OCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C12H22O3Si/c1-6-11(16(3,4)5)10(13)9-12(2)14-7-8-15-12/h10,13H,1,7-9H2,2-5H3 |
| InChIKey | VJRQDLOCCXIQKX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|