C11H22O3Si — CID 11218483
(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trimethylsilylprop-2-en-1-ol (PubChem CID 11218483) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trimethylsilylprop-2-en-1-ol.
| Compound Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trimethylsilylprop-2-en-1-ol |
|---|---|
| PubChem CID | 11218483 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-trimethylsilylprop-2-en-1-ol |
| SMILES | C=C([C@@H](O)[C@H]1COC(C)(C)O1)[Si](C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-8(15(4,5)6)10(12)9-7-13-11(2,3)14-9/h9-10,12H,1,7H2,2-6H3/t9-,10-/m1/s1 |
| InChIKey | ZWJMVMWDQWSNOB-NXEZZACHSA-N |
| XLogP | 1.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|