C6H13NO2 — CID 106821578
N,3-dimethoxycyclobutan-1-amine (PubChem CID 106821578) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is N,3-dimethoxycyclobutan-1-amine.
| Compound Name | N,3-dimethoxycyclobutan-1-amine |
|---|---|
| PubChem CID | 106821578 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | N,3-dimethoxycyclobutan-1-amine |
| SMILES | CONC1CC(OC)C1 |
| InChI | InChI=1S/C6H13NO2/c1-8-6-3-5(4-6)7-9-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | HCQVCBDIDBHBAA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|