C8H16N2O2 — CID 104581744
3-(3-methoxycyclobutyl)-1,1-dimethylurea (PubChem CID 104581744) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 3-(3-methoxycyclobutyl)-1,1-dimethylurea.
| Compound Name | 3-(3-methoxycyclobutyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 104581744 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 3-(3-methoxycyclobutyl)-1,1-dimethylurea |
| SMILES | COC1CC(NC(=O)N(C)C)C1 |
| InChI | InChI=1S/C8H16N2O2/c1-10(2)8(11)9-6-4-7(5-6)12-3/h6-7H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | XFZXVIOJSURDGR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |