C8H15NO3 — CID 131069206
(2S)-2-hydroxy-N-(3-methoxycyclobutyl)propanamide (PubChem CID 131069206) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (2S)-2-hydroxy-N-(3-methoxycyclobutyl)propanamide.
| Compound Name | (2S)-2-hydroxy-N-(3-methoxycyclobutyl)propanamide |
|---|---|
| PubChem CID | 131069206 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (2S)-2-hydroxy-N-(3-methoxycyclobutyl)propanamide |
| SMILES | COC1CC(NC(=O)[C@H](C)O)C1 |
| InChI | InChI=1S/C8H15NO3/c1-5(10)8(11)9-6-3-7(4-6)12-2/h5-7,10H,3-4H2,1-2H3,(H,9,11)/t5-,6?,7?/m0/s1 |
| InChIKey | XJTPAYVLDRNLTD-VTSJMVTISA-N |
| XLogP | -0.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |