C15H16FNO3 — CID 106824849
9-(3-fluorophenyl)-2-methoxy-7-azaspiro[3.5]nonane-6,8-dione (PubChem CID 106824849) has the molecular formula C15H16FNO3 and a molecular weight of 277.30 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-2-methoxy-7-azaspiro[3.5]nonane-6,8-dione.
| Compound Name | 9-(3-fluorophenyl)-2-methoxy-7-azaspiro[3.5]nonane-6,8-dione |
|---|---|
| PubChem CID | 106824849 |
| Molecular Formula | C15H16FNO3 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 9-(3-fluorophenyl)-2-methoxy-7-azaspiro[3.5]nonane-6,8-dione |
| SMILES | COC1CC2(CC(=O)NC(=O)C2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H16FNO3/c1-20-11-6-15(7-11)8-12(18)17-14(19)13(15)9-3-2-4-10(16)5-9/h2-5,11,13H,6-8H2,1H3,(H,17,18,19) |
| InChIKey | QHNHCSADTZXZDU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|