C13H20O5 — CID 10682496
diethyl 2,4-dimethyl-2,5-dihydropyran-6,6-dicarboxylate (PubChem CID 10682496) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is diethyl 2,4-dimethyl-2,5-dihydropyran-6,6-dicarboxylate.
| Compound Name | diethyl 2,4-dimethyl-2,5-dihydropyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 10682496 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | diethyl 2,4-dimethyl-2,5-dihydropyran-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(C)=CC(C)O1 |
| InChI | InChI=1S/C13H20O5/c1-5-16-11(14)13(12(15)17-6-2)8-9(3)7-10(4)18-13/h7,10H,5-6,8H2,1-4H3 |
| InChIKey | DFDAVEXWPBRZLE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|