C14H10O3S — CID 10682625
6-phenylmethoxy-1,3-benzoxathiol-2-one (PubChem CID 10682625) has the molecular formula C14H10O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 6-phenylmethoxy-1,3-benzoxathiol-2-one.
| Compound Name | 6-phenylmethoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 10682625 |
| Molecular Formula | C14H10O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 6-phenylmethoxy-1,3-benzoxathiol-2-one |
| SMILES | O=c1oc2cc(OCc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C14H10O3S/c15-14-17-12-8-11(6-7-13(12)18-14)16-9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | BIRJEQFYQXARRR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |