C12H8O3S2 — CID 22010465
6-(thiophen-3-ylmethoxy)-1,3-benzoxathiol-2-one (PubChem CID 22010465) has the molecular formula C12H8O3S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 6-(thiophen-3-ylmethoxy)-1,3-benzoxathiol-2-one.
| Compound Name | 6-(thiophen-3-ylmethoxy)-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 22010465 |
| Molecular Formula | C12H8O3S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 6-(thiophen-3-ylmethoxy)-1,3-benzoxathiol-2-one |
| SMILES | O=c1oc2cc(OCc3ccsc3)ccc2s1 |
| InChI | InChI=1S/C12H8O3S2/c13-12-15-10-5-9(1-2-11(10)17-12)14-6-8-3-4-16-7-8/h1-5,7H,6H2 |
| InChIKey | WNGLVQZRYIEACN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |