C12H13NO2S — CID 105496526
6-[2-(1-aminocyclopropyl)ethyl]-1,3-benzoxathiol-2-one (PubChem CID 105496526) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-[2-(1-aminocyclopropyl)ethyl]-1,3-benzoxathiol-2-one.
| Compound Name | 6-[2-(1-aminocyclopropyl)ethyl]-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 105496526 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 6-[2-(1-aminocyclopropyl)ethyl]-1,3-benzoxathiol-2-one |
| SMILES | NC1(CCc2ccc3sc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C12H13NO2S/c13-12(5-6-12)4-3-8-1-2-10-9(7-8)15-11(14)16-10/h1-2,7H,3-6,13H2 |
| InChIKey | ISGGHWUOXINDBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |