C22H24O5S — CID 86058456
(2-oxo-1,3-benzoxathiol-6-yl) 4-octoxybenzoate (PubChem CID 86058456) has the molecular formula C22H24O5S and a molecular weight of 400.50 g/mol. Its IUPAC name is (2-oxo-1,3-benzoxathiol-6-yl) 4-octoxybenzoate.
| Compound Name | (2-oxo-1,3-benzoxathiol-6-yl) 4-octoxybenzoate |
|---|---|
| PubChem CID | 86058456 |
| Molecular Formula | C22H24O5S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (2-oxo-1,3-benzoxathiol-6-yl) 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc3sc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H24O5S/c1-2-3-4-5-6-7-14-25-17-10-8-16(9-11-17)21(23)26-18-12-13-20-19(15-18)27-22(24)28-20/h8-13,15H,2-7,14H2,1H3 |
| InChIKey | ONIJGIUNBCCLKY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|