C17H25NO2 — CID 106827698
N-[1-(2-hydroxyphenyl)ethyl]-N,1-dimethylcyclohexane-1-carboxamide (PubChem CID 106827698) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethyl]-N,1-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethyl]-N,1-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106827698 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethyl]-N,1-dimethylcyclohexane-1-carboxamide |
| SMILES | CC(c1ccccc1O)N(C)C(=O)C1(C)CCCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-13(14-9-5-6-10-15(14)19)18(3)16(20)17(2)11-7-4-8-12-17/h5-6,9-10,13,19H,4,7-8,11-12H2,1-3H3 |
| InChIKey | VAJAPRRDHASLMH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|