C15H22N2O2 — CID 112725664
N-[1-(2-hydroxyphenyl)ethyl]-N-methylpiperidine-1-carboxamide (PubChem CID 112725664) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[1-(2-hydroxyphenyl)ethyl]-N-methylpiperidine-1-carboxamide.
| Compound Name | N-[1-(2-hydroxyphenyl)ethyl]-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 112725664 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[1-(2-hydroxyphenyl)ethyl]-N-methylpiperidine-1-carboxamide |
| SMILES | CC(c1ccccc1O)N(C)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-12(13-8-4-5-9-14(13)18)16(2)15(19)17-10-6-3-7-11-17/h4-5,8-9,12,18H,3,6-7,10-11H2,1-2H3 |
| InChIKey | UAFWEVSLFCNIAD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|