C16H28BrNO — CID 106829038
N-[1-(bromomethyl)-3-methylcyclohexyl]-1-methylcyclohexane-1-carboxamide (PubChem CID 106829038) has the molecular formula C16H28BrNO and a molecular weight of 330.31 g/mol. Its IUPAC name is N-[1-(bromomethyl)-3-methylcyclohexyl]-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106829038 |
| Molecular Formula | C16H28BrNO |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[1-(bromomethyl)-3-methylcyclohexyl]-1-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCCC(CBr)(NC(=O)C2(C)CCCCC2)C1 |
| InChI | InChI=1S/C16H28BrNO/c1-13-7-6-10-16(11-13,12-17)18-14(19)15(2)8-4-3-5-9-15/h13H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | DJQFXGCPSPYVBT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|