C8H12N4S — CID 106831708
1-ethyl-3-(pyridazin-3-ylmethyl)thiourea (PubChem CID 106831708) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 1-ethyl-3-(pyridazin-3-ylmethyl)thiourea.
| Compound Name | 1-ethyl-3-(pyridazin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 106831708 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 1-ethyl-3-(pyridazin-3-ylmethyl)thiourea |
| SMILES | CCNC(=S)NCc1cccnn1 |
| InChI | InChI=1S/C8H12N4S/c1-2-9-8(13)10-6-7-4-3-5-11-12-7/h3-5H,2,6H2,1H3,(H2,9,10,13) |
| InChIKey | DLOOLJTUEHXYJV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|