C9H15N5S — CID 20557856
1-methyl-3-[2-(pyridazin-3-ylmethylamino)ethyl]thiourea (PubChem CID 20557856) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 1-methyl-3-[2-(pyridazin-3-ylmethylamino)ethyl]thiourea.
| Compound Name | 1-methyl-3-[2-(pyridazin-3-ylmethylamino)ethyl]thiourea |
|---|---|
| PubChem CID | 20557856 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-methyl-3-[2-(pyridazin-3-ylmethylamino)ethyl]thiourea |
| SMILES | CNC(=S)NCCNCc1cccnn1 |
| InChI | InChI=1S/C9H15N5S/c1-10-9(15)12-6-5-11-7-8-3-2-4-13-14-8/h2-4,11H,5-7H2,1H3,(H2,10,12,15) |
| InChIKey | OONSBXATHMSZGE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|