C11H8F2N4O2 — CID 106832701
2,6-difluoro-4-nitro-N-(pyridazin-3-ylmethyl)aniline (PubChem CID 106832701) has the molecular formula C11H8F2N4O2 and a molecular weight of 266.21 g/mol. Its IUPAC name is 2,6-difluoro-4-nitro-N-(pyridazin-3-ylmethyl)aniline.
| Compound Name | 2,6-difluoro-4-nitro-N-(pyridazin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 106832701 |
| Molecular Formula | C11H8F2N4O2 |
| Molecular Weight | 266.21 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2,6-difluoro-4-nitro-N-(pyridazin-3-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(F)c(NCc2cccnn2)c(F)c1 |
| InChI | InChI=1S/C11H8F2N4O2/c12-9-4-8(17(18)19)5-10(13)11(9)14-6-7-2-1-3-15-16-7/h1-5,14H,6H2 |
| InChIKey | ZAQVOIWXCPZFJL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|