C12H12ClN5 — CID 106832785
6-chloro-2-cyclopropyl-N-(pyridazin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 106832785) has the molecular formula C12H12ClN5 and a molecular weight of 261.72 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(pyridazin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(pyridazin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106832785 |
| Molecular Formula | C12H12ClN5 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(pyridazin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | Clc1cc(NCc2cccnn2)nc(C2CC2)n1 |
| InChI | InChI=1S/C12H12ClN5/c13-10-6-11(17-12(16-10)8-3-4-8)14-7-9-2-1-5-15-18-9/h1-2,5-6,8H,3-4,7H2,(H,14,16,17) |
| InChIKey | ZJSGFZSCEKEBIK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |