C15H24F3NO2 — CID 106834342
[4-(1-hydroxyethyl)piperidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone (PubChem CID 106834342) has the molecular formula C15H24F3NO2 and a molecular weight of 307.36 g/mol. Its IUPAC name is [4-(1-hydroxyethyl)piperidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone.
| Compound Name | [4-(1-hydroxyethyl)piperidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 106834342 |
| Molecular Formula | C15H24F3NO2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [4-(1-hydroxyethyl)piperidin-1-yl]-[4-(trifluoromethyl)cyclohexyl]methanone |
| SMILES | CC(O)C1CCN(C(=O)C2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C15H24F3NO2/c1-10(20)11-6-8-19(9-7-11)14(21)12-2-4-13(5-3-12)15(16,17)18/h10-13,20H,2-9H2,1H3 |
| InChIKey | HTDIZUMVRIVADA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |