C13H18BrNO2S — CID 106836574
1-(3-bromothiophen-2-yl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone (PubChem CID 106836574) has the molecular formula C13H18BrNO2S and a molecular weight of 332.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(3-bromothiophen-2-yl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 106836574 |
| Molecular Formula | C13H18BrNO2S |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-2-[4-(1-hydroxyethyl)piperidin-1-yl]ethanone |
| SMILES | CC(O)C1CCN(CC(=O)c2sccc2Br)CC1 |
| InChI | InChI=1S/C13H18BrNO2S/c1-9(16)10-2-5-15(6-3-10)8-12(17)13-11(14)4-7-18-13/h4,7,9-10,16H,2-3,5-6,8H2,1H3 |
| InChIKey | HKZAKAADYYOEFS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |