C12H15BrClNOS — CID 106839081
(3-bromothiophen-2-yl)-[4-(1-chloroethyl)piperidin-1-yl]methanone (PubChem CID 106839081) has the molecular formula C12H15BrClNOS and a molecular weight of 336.68 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-[4-(1-chloroethyl)piperidin-1-yl]methanone.
| Compound Name | (3-bromothiophen-2-yl)-[4-(1-chloroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 106839081 |
| Molecular Formula | C12H15BrClNOS |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | (3-bromothiophen-2-yl)-[4-(1-chloroethyl)piperidin-1-yl]methanone |
| SMILES | CC(Cl)C1CCN(C(=O)c2sccc2Br)CC1 |
| InChI | InChI=1S/C12H15BrClNOS/c1-8(14)9-2-5-15(6-3-9)12(16)11-10(13)4-7-17-11/h4,7-9H,2-3,5-6H2,1H3 |
| InChIKey | FQONUJQSGQVZLN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|