C9H9Br2NOS — CID 80677244
(3-bromopyrrolidin-1-yl)-(3-bromothiophen-2-yl)methanone (PubChem CID 80677244) has the molecular formula C9H9Br2NOS and a molecular weight of 339.05 g/mol. Its IUPAC name is (3-bromopyrrolidin-1-yl)-(3-bromothiophen-2-yl)methanone.
| Compound Name | (3-bromopyrrolidin-1-yl)-(3-bromothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 80677244 |
| Molecular Formula | C9H9Br2NOS |
| Molecular Weight | 339.05 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | (3-bromopyrrolidin-1-yl)-(3-bromothiophen-2-yl)methanone |
| SMILES | O=C(c1sccc1Br)N1CCC(Br)C1 |
| InChI | InChI=1S/C9H9Br2NOS/c10-6-1-3-12(5-6)9(13)8-7(11)2-4-14-8/h2,4,6H,1,3,5H2 |
| InChIKey | FUFFBXZIASBQRW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.05 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|