C9H8BrNOS — CID 130616054
(3-bromothiophen-2-yl)-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 130616054) has the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | (3-bromothiophen-2-yl)-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 130616054 |
| Molecular Formula | C9H8BrNOS |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | (3-bromothiophen-2-yl)-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(c1sccc1Br)N1CC=CC1 |
| InChI | InChI=1S/C9H8BrNOS/c10-7-3-6-13-8(7)9(12)11-4-1-2-5-11/h1-3,6H,4-5H2 |
| InChIKey | PDBLFVBTLCBVAX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|