C10H10BrNOS — CID 115970006
(3-bromothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 115970006) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (3-bromothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 115970006 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | (3-bromothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(c1sccc1Br)N1CC=CCC1 |
| InChI | InChI=1S/C10H10BrNOS/c11-8-4-7-14-9(8)10(13)12-5-2-1-3-6-12/h1-2,4,7H,3,5-6H2 |
| InChIKey | IKBUJRVWVMEZKG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|