C14H13BrN2OS — CID 114889371
(3-amino-4-bromo-1-benzothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114889371) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is (3-amino-4-bromo-1-benzothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114889371 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | Nc1c(C(=O)N2CC=CCC2)sc2cccc(Br)c12 |
| InChI | InChI=1S/C14H13BrN2OS/c15-9-5-4-6-10-11(9)12(16)13(19-10)14(18)17-7-2-1-3-8-17/h1-2,4-6H,3,7-8,16H2 |
| InChIKey | GKKBRDVJUMQYKH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|