C13H13BrN2OS — CID 114888877
3-amino-4-bromo-N-(cyclopropylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 114888877) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(cyclopropylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-bromo-N-(cyclopropylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114888877 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-amino-4-bromo-N-(cyclopropylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)NCC2CC2)sc2cccc(Br)c12 |
| InChI | InChI=1S/C13H13BrN2OS/c14-8-2-1-3-9-10(8)11(15)12(18-9)13(17)16-6-7-4-5-7/h1-3,7H,4-6,15H2,(H,16,17) |
| InChIKey | BWHIJFTVXHOIPF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |