C14H15BrN2O2S — CID 114889212
3-amino-4-bromo-N-[(3-hydroxycyclobutyl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 114889212) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is 3-amino-4-bromo-N-[(3-hydroxycyclobutyl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-bromo-N-[(3-hydroxycyclobutyl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114889212 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-amino-4-bromo-N-[(3-hydroxycyclobutyl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)NCC2CC(O)C2)sc2cccc(Br)c12 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-9-2-1-3-10-11(9)12(16)13(20-10)14(19)17-6-7-4-8(18)5-7/h1-3,7-8,18H,4-6,16H2,(H,17,19) |
| InChIKey | RGIRXRWRQXTUPB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |