C14H15BrN2O3S — CID 114889369
(3-amino-4-bromo-1-benzothiophen-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 114889369) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is (3-amino-4-bromo-1-benzothiophen-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 114889369 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | Nc1c(C(=O)N2CCOCC2CO)sc2cccc(Br)c12 |
| InChI | InChI=1S/C14H15BrN2O3S/c15-9-2-1-3-10-11(9)12(16)13(21-10)14(19)17-4-5-20-7-8(17)6-18/h1-3,8,18H,4-7,16H2 |
| InChIKey | OEZXHMSZSTXMNO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |