C14H16BrN3OS — CID 114889019
(3-amino-4-bromo-1-benzothiophen-2-yl)-(3-aminopiperidin-1-yl)methanone (PubChem CID 114889019) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is (3-amino-4-bromo-1-benzothiophen-2-yl)-(3-aminopiperidin-1-yl)methanone.
| Compound Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-(3-aminopiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114889019 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (3-amino-4-bromo-1-benzothiophen-2-yl)-(3-aminopiperidin-1-yl)methanone |
| SMILES | Nc1c(C(=O)N2CCCC(N)C2)sc2cccc(Br)c12 |
| InChI | InChI=1S/C14H16BrN3OS/c15-9-4-1-5-10-11(9)12(17)13(20-10)14(19)18-6-2-3-8(16)7-18/h1,4-5,8H,2-3,6-7,16-17H2 |
| InChIKey | HDVJGWWPHIEFFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |