C10H12N2OS — CID 114407063
(3-aminothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 114407063) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is (3-aminothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (3-aminothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 114407063 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (3-aminothiophen-2-yl)-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | Nc1ccsc1C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C10H12N2OS/c11-8-4-7-14-9(8)10(13)12-5-2-1-3-6-12/h1-2,4,7H,3,5-6,11H2 |
| InChIKey | NBHUWFSKSPJESU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|