C13H21N3O3S — CID 106837532
1-[1-[[3-(methylamino)-2-pyridinyl]sulfonyl]piperidin-4-yl]ethanol (PubChem CID 106837532) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[1-[[3-(methylamino)-2-pyridinyl]sulfonyl]piperidin-4-yl]ethanol.
| Compound Name | 1-[1-[[3-(methylamino)-2-pyridinyl]sulfonyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 106837532 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[1-[[3-(methylamino)-2-pyridinyl]sulfonyl]piperidin-4-yl]ethanol |
| SMILES | CNc1cccnc1S(=O)(=O)N1CCC(C(C)O)CC1 |
| InChI | InChI=1S/C13H21N3O3S/c1-10(17)11-5-8-16(9-6-11)20(18,19)13-12(14-2)4-3-7-15-13/h3-4,7,10-11,14,17H,5-6,8-9H2,1-2H3 |
| InChIKey | DPUMFMQKHZBKKM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |