C13H20ClN3 — CID 106838567
3-[4-(1-chloroethyl)piperidin-1-yl]-2,5-dimethylpyrazine (PubChem CID 106838567) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is 3-[4-(1-chloroethyl)piperidin-1-yl]-2,5-dimethylpyrazine.
| Compound Name | 3-[4-(1-chloroethyl)piperidin-1-yl]-2,5-dimethylpyrazine |
|---|---|
| PubChem CID | 106838567 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-[4-(1-chloroethyl)piperidin-1-yl]-2,5-dimethylpyrazine |
| SMILES | Cc1cnc(C)c(N2CCC(C(C)Cl)CC2)n1 |
| InChI | InChI=1S/C13H20ClN3/c1-9-8-15-11(3)13(16-9)17-6-4-12(5-7-17)10(2)14/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | ACPKGTDVUFEZMN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|