C11H16N2O3 — CID 106843109
N-(4-hydroxybutyl)-3-methoxypyridine-4-carboxamide (PubChem CID 106843109) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-3-methoxypyridine-4-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-3-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 106843109 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-(4-hydroxybutyl)-3-methoxypyridine-4-carboxamide |
| SMILES | COc1cnccc1C(=O)NCCCCO |
| InChI | InChI=1S/C11H16N2O3/c1-16-10-8-12-6-4-9(10)11(15)13-5-2-3-7-14/h4,6,8,14H,2-3,5,7H2,1H3,(H,13,15) |
| InChIKey | AIWDEBODVFKKSK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|