C9H16BrN3 — CID 106844741
4-bromo-N-[(1-methylpyrazol-3-yl)methyl]butan-1-amine (PubChem CID 106844741) has the molecular formula C9H16BrN3 and a molecular weight of 246.15 g/mol. Its IUPAC name is 4-bromo-N-[(1-methylpyrazol-3-yl)methyl]butan-1-amine.
| Compound Name | 4-bromo-N-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844741 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 4-bromo-N-[(1-methylpyrazol-3-yl)methyl]butan-1-amine |
| SMILES | Cn1ccc(CNCCCCBr)n1 |
| InChI | InChI=1S/C9H16BrN3/c1-13-7-4-9(12-13)8-11-6-3-2-5-10/h4,7,11H,2-3,5-6,8H2,1H3 |
| InChIKey | AAOQHUOYORXUPB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|