C7H10N4 — CID 82881600
2-[(1-methylpyrazol-3-yl)methylamino]acetonitrile (PubChem CID 82881600) has the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-3-yl)methylamino]acetonitrile.
| Compound Name | 2-[(1-methylpyrazol-3-yl)methylamino]acetonitrile |
|---|---|
| PubChem CID | 82881600 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 2-[(1-methylpyrazol-3-yl)methylamino]acetonitrile |
| SMILES | Cn1ccc(CNCC#N)n1 |
| InChI | InChI=1S/C7H10N4/c1-11-5-2-7(10-11)6-9-4-3-8/h2,5,9H,4,6H2,1H3 |
| InChIKey | HXCIULAUZZBPAL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|