C12H17Br2NO — CID 106844843
4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine (PubChem CID 106844843) has the molecular formula C12H17Br2NO and a molecular weight of 351.08 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine.
| Compound Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844843 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methyl]butan-1-amine |
| SMILES | COc1ccc(Br)cc1CNCCCCBr |
| InChI | InChI=1S/C12H17Br2NO/c1-16-12-5-4-11(14)8-10(12)9-15-7-3-2-6-13/h4-5,8,15H,2-3,6-7,9H2,1H3 |
| InChIKey | DXLZWMUOWQFKKD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|