C13H21BrN2O — CID 115203177
N'-[(5-bromo-2-methoxyphenyl)methyl]-2-methylbutane-1,4-diamine (PubChem CID 115203177) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is N'-[(5-bromo-2-methoxyphenyl)methyl]-2-methylbutane-1,4-diamine.
| Compound Name | N'-[(5-bromo-2-methoxyphenyl)methyl]-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115203177 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N'-[(5-bromo-2-methoxyphenyl)methyl]-2-methylbutane-1,4-diamine |
| SMILES | COc1ccc(Br)cc1CNCCC(C)CN |
| InChI | InChI=1S/C13H21BrN2O/c1-10(8-15)5-6-16-9-11-7-12(14)3-4-13(11)17-2/h3-4,7,10,16H,5-6,8-9,15H2,1-2H3 |
| InChIKey | MAEUCVBJMIQDLZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|