C11H14ClN3O4 — CID 10684730
[(3aS,4R,5S,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 10684730) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is [(3aS,4R,5S,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aS,4R,5S,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 10684730 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [(3aS,4R,5S,7aS)-5-azido-7-chloro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C(Cl)=C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C11H14ClN3O4/c1-5(16)17-9-7(14-15-13)4-6(12)8-10(9)19-11(2,3)18-8/h4,7-10H,1-3H3/t7-,8+,9+,10+/m0/s1 |
| InChIKey | RFYUQHUFMUWIMC-SGIHWFKDSA-N |
| XLogP | 2.25 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|