C19H28O2 — CID 10684796
(Z)-4-(1-hydroxy-1-phenylethyl)-2,2-dimethylnon-4-en-3-one (PubChem CID 10684796) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (Z)-4-(1-hydroxy-1-phenylethyl)-2,2-dimethylnon-4-en-3-one.
| Compound Name | (Z)-4-(1-hydroxy-1-phenylethyl)-2,2-dimethylnon-4-en-3-one |
|---|---|
| PubChem CID | 10684796 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (Z)-4-(1-hydroxy-1-phenylethyl)-2,2-dimethylnon-4-en-3-one |
| SMILES | CCCC/C=C(\C(=O)C(C)(C)C)C(C)(O)c1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-6-7-9-14-16(17(20)18(2,3)4)19(5,21)15-12-10-8-11-13-15/h8,10-14,21H,6-7,9H2,1-5H3/b16-14+ |
| InChIKey | XXAFVZJIAMLZRU-JQIJEIRASA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|